About N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide
N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide (PubChem CID 166506836) has the molecular formula C11H21NO3S
and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 166506836 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@H](CO)[C@@H]1CCC=CO1 |
| InChI | InChI=1S/C11H21NO3S/c1-11(2,3)16(14)12-9(8-13)10-6-4-5-7-15-10/h5,7,9-10,12-13H,4,6,8H2,1-3H3/t9-,10+,16?/m1/s1 |
| InChIKey | HBLXSMQGYFLYQZ-KXTRXUQASA-N |
| XLogP | 1.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide (CID 166506836) is N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)N[C@H](CO)[C@@H]1CCC=CO1.
What is the InChIKey of N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is HBLXSMQGYFLYQZ-KXTRXUQASA-N. The full InChI is InChI=1S/C11H21NO3S/c1-11(2,3)16(14)12-9(8-13)10-6-4-5-7-15-10/h5,7,9-10,12-13H,4,6,8H2,1-3H3/t9-,10+,16?/m1/s1.
What are the key properties of N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide?
N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 247.36 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-hydroxyethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 166506836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).