C17H16ClN5O2S — CID 16650689
N-(2-chlorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 16650689) has the molecular formula C17H16ClN5O2S and a molecular weight of 389.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(2-chlorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 16650689 |
| Molecular Formula | C17H16ClN5O2S |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | COc1ccccc1-n1nnnc1SC(C)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN5O2S/c1-11(16(24)19-13-8-4-3-7-12(13)18)26-17-20-21-22-23(17)14-9-5-6-10-15(14)25-2/h3-11H,1-2H3,(H,19,24) |
| InChIKey | YGGCDBXOOICLRG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |