About 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one
6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one (PubChem CID 166507256) has the molecular formula C16H20F3NO
and a molecular weight of 299.34 g/mol. Its IUPAC name is 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one.
Molecular Properties
| Compound Name | 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one |
| PubChem CID | 166507256 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one |
| SMILES | CN1C(=O)c2cc(C(C)(C)C)cc(C(F)(F)F)c2C1(C)C |
| InChI | InChI=1S/C16H20F3NO/c1-14(2,3)9-7-10-12(11(8-9)16(17,18)19)15(4,5)20(6)13(10)21/h7-8H,1-6H3 |
| InChIKey | IORDDTYTQSYSKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one?
The IUPAC name of 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one (CID 166507256) is 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one.
What is the SMILES notation for 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one?
The canonical SMILES for 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one is CN1C(=O)c2cc(C(C)(C)C)cc(C(F)(F)F)c2C1(C)C.
What is the InChIKey of 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one?
The InChIKey is IORDDTYTQSYSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3NO/c1-14(2,3)9-7-10-12(11(8-9)16(17,18)19)15(4,5)20(6)13(10)21/h7-8H,1-6H3.
What are the key properties of 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one?
6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one has a molecular weight of 299.34 g/mol, XLogP of 4.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,3,3-trimethyl-4-(trifluoromethyl)isoindol-1-one is sourced from PubChem (CID 166507256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).