C8H12N2O2 — CID 166507553
(3aR,6aS)-3-cyclopropyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 166507553) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (3aR,6aS)-3-cyclopropyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,6aS)-3-cyclopropyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 166507553 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (3aR,6aS)-3-cyclopropyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@H]2CNC[C@H]2N1C1CC1 |
| InChI | InChI=1S/C8H12N2O2/c11-8-10(5-1-2-5)6-3-9-4-7(6)12-8/h5-7,9H,1-4H2/t6-,7+/m1/s1 |
| InChIKey | IZNRBCAAMVJBNU-RQJHMYQMSA-N |
| XLogP | -0.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |