About 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane
4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 166507974) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane |
| PubChem CID | 166507974 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | CC(C)N1CC2C3CCC(N3)C2C1 |
| InChI | InChI=1S/C11H20N2/c1-7(2)13-5-8-9(6-13)11-4-3-10(8)12-11/h7-12H,3-6H2,1-2H3 |
| InChIKey | CGVJBNRBZSWCNQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane?
The IUPAC name of 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane (CID 166507974) is 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane?
The canonical SMILES for 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane is CC(C)N1CC2C3CCC(N3)C2C1.
What is the InChIKey of 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane?
The InChIKey is CGVJBNRBZSWCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-7(2)13-5-8-9(6-13)11-4-3-10(8)12-11/h7-12H,3-6H2,1-2H3.
What are the key properties of 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane?
4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane has a molecular weight of 180.29 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-4,10-diazatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 166507974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).