C9H11N3O — CID 166508037
6-methoxy-2-methylpyrazolo[1,5-a]pyridin-5-amine (PubChem CID 166508037) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-methoxy-2-methylpyrazolo[1,5-a]pyridin-5-amine.
| Compound Name | 6-methoxy-2-methylpyrazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 166508037 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 6-methoxy-2-methylpyrazolo[1,5-a]pyridin-5-amine |
| SMILES | COc1cn2nc(C)cc2cc1N |
| InChI | InChI=1S/C9H11N3O/c1-6-3-7-4-8(10)9(13-2)5-12(7)11-6/h3-5H,10H2,1-2H3 |
| InChIKey | MROQOMZSTDHROC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |