C38H26N2O — CID 166509482
2-[4-[2,3,5,6-tetradeuterio-4-[3,4-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrofuran-5-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166509482) has the molecular formula C38H26N2O and a molecular weight of 537.71 g/mol. Its IUPAC name is 2-[4-[2,3,5,6-tetradeuterio-4-[3,4-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrofuran-5-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-[2,3,5,6-tetradeuterio-4-[3,4-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrofuran-5-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166509482 |
| Molecular Formula | C38H26N2O |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 2-[4-[2,3,5,6-tetradeuterio-4-[3,4-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydrofuran-5-yl]phenyl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]C1=C(c2c([2H])c([2H])c(-c3ccc(-c4ccc5ccc6cccnc6c5n4)c4ccccc34)c([2H])c2[2H])OC(c2c([2H])c([2H])c([2H])c([2H])c2[2H])C1[2H] |
| InChI | InChI=1S/C38H26N2O/c1-2-7-26(8-3-1)35-22-23-36(41-35)27-14-12-25(13-15-27)30-19-20-33(32-11-5-4-10-31(30)32)34-21-18-29-17-16-28-9-6-24-39-37(28)38(29)40-34/h1-21,23-24,35H,22H2/i1D,2D,3D,7D,8D,12D,13D,14D,15D,22D,23D |
| InChIKey | PFZGPNDPJOUSMG-CBPDCWAQSA-N |
| XLogP | 9.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|