C50H33N2OP — CID 166509862
[8-[4-[4-[6-(4-naphthalen-1-ylphenyl)-2-phenylpyrimidin-4-yl]phenyl]phenyl]dibenzofuran-3-yl]phosphane (PubChem CID 166509862) has the molecular formula C50H33N2OP and a molecular weight of 708.80 g/mol. Its IUPAC name is [8-[4-[4-[6-(4-naphthalen-1-ylphenyl)-2-phenylpyrimidin-4-yl]phenyl]phenyl]dibenzofuran-3-yl]phosphane.
| Compound Name | [8-[4-[4-[6-(4-naphthalen-1-ylphenyl)-2-phenylpyrimidin-4-yl]phenyl]phenyl]dibenzofuran-3-yl]phosphane |
|---|---|
| PubChem CID | 166509862 |
| Molecular Formula | C50H33N2OP |
| Molecular Weight | 708.80 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | [8-[4-[4-[6-(4-naphthalen-1-ylphenyl)-2-phenylpyrimidin-4-yl]phenyl]phenyl]dibenzofuran-3-yl]phosphane |
| SMILES | Pc1ccc2c(c1)oc1ccc(-c3ccc(-c4ccc(-c5cc(-c6ccc(-c7cccc8ccccc78)cc6)nc(-c6ccccc6)n5)cc4)cc3)cc12 |
| InChI | InChI=1S/C50H33N2OP/c54-41-26-27-44-45-29-40(25-28-48(45)53-49(44)30-41)34-15-13-32(14-16-34)33-17-21-37(22-18-33)46-31-47(52-50(51-46)39-8-2-1-3-9-39)38-23-19-36(20-24-38)43-12-6-10-35-7-4-5-11-42(35)43/h1-31H,54H2 |
| InChIKey | VSXRXPKXFDQJIW-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.80 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|