C30H33F3O6 — CID 166510709
[(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 166510709) has the molecular formula C30H33F3O6 and a molecular weight of 546.58 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 166510709 |
| Molecular Formula | C30H33F3O6 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)C[C@]4(OC(=O)/C=C/c5ccc(C(F)(F)F)cc5)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C30H33F3O6/c1-16-11-22-27(37,25(16)36)14-19(15-34)12-21-24-26(3,4)28(24,13-17(2)29(21,22)38)39-23(35)10-7-18-5-8-20(9-6-18)30(31,32)33/h5-12,17,21-22,24,34,37-38H,13-15H2,1-4H3/b10-7+/t17-,21+,22-,24-,27-,28+,29-/m1/s1 |
| InChIKey | DPOHIAWRNUJEBG-BVQPBZSGSA-N |
| XLogP | 4.24 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|