C8H12N2O3 — CID 166510821
(6R)-6-(2-methylpropanoyl)-1,3-diazinane-2,4-dione (PubChem CID 166510821) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is (6R)-6-(2-methylpropanoyl)-1,3-diazinane-2,4-dione.
| Compound Name | (6R)-6-(2-methylpropanoyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 166510821 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (6R)-6-(2-methylpropanoyl)-1,3-diazinane-2,4-dione |
| SMILES | CC(C)C(=O)[C@H]1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C8H12N2O3/c1-4(2)7(12)5-3-6(11)10-8(13)9-5/h4-5H,3H2,1-2H3,(H2,9,10,11,13)/t5-/m1/s1 |
| InChIKey | CLASYMKTUGCSHR-RXMQYKEDSA-N |
| XLogP | -0.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |