About 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide
1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide (PubChem CID 166510915) has the molecular formula C13H22Cl2N2O2
and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide |
| PubChem CID | 166510915 |
| Molecular Formula | C13H22Cl2N2O2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC2CC(Cl)C(Cl)CC2O)CC1 |
| InChI | InChI=1S/C13H22Cl2N2O2/c14-10-5-9(12(18)6-11(10)15)7-17-3-1-8(2-4-17)13(16)19/h8-12,18H,1-7H2,(H2,16,19) |
| InChIKey | WUDMEFHYLBAUGV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide?
The IUPAC name of 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide (CID 166510915) is 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide is NC(=O)C1CCN(CC2CC(Cl)C(Cl)CC2O)CC1.
What is the InChIKey of 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide?
The InChIKey is WUDMEFHYLBAUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22Cl2N2O2/c14-10-5-9(12(18)6-11(10)15)7-17-3-1-8(2-4-17)13(16)19/h8-12,18H,1-7H2,(H2,16,19).
What are the key properties of 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide?
1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide has a molecular weight of 309.24 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-4-carboxamide is sourced from PubChem (CID 166510915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).