C13H19N2O8P — CID 166512104
N-[(4S,7R)-3-(2,4-dioxo-1-pyridinyl)-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-methoxyphosphonamidic acid (PubChem CID 166512104) has the molecular formula C13H19N2O8P and a molecular weight of 362.28 g/mol. Its IUPAC name is N-[(4S,7R)-3-(2,4-dioxo-1-pyridinyl)-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-methoxyphosphonamidic acid.
| Compound Name | N-[(4S,7R)-3-(2,4-dioxo-1-pyridinyl)-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-methoxyphosphonamidic acid |
|---|---|
| PubChem CID | 166512104 |
| Molecular Formula | C13H19N2O8P |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[(4S,7R)-3-(2,4-dioxo-1-pyridinyl)-1-(methoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]-methoxyphosphonamidic acid |
| SMILES | COCC12CO[C@H](C(N3C=CC(=O)CC3=O)O1)[C@H]2NP(=O)(O)OC |
| InChI | InChI=1S/C13H19N2O8P/c1-20-6-13-7-22-10(11(13)14-24(18,19)21-2)12(23-13)15-4-3-8(16)5-9(15)17/h3-4,10-12H,5-7H2,1-2H3,(H2,14,18,19)/t10-,11+,12?,13?/m0/s1 |
| InChIKey | JJVHVMHSFVUPJB-ZFDZMSFRSA-N |
| XLogP | -0.85 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|