C13H10F2N2OS2 — CID 166512123
1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone (PubChem CID 166512123) has the molecular formula C13H10F2N2OS2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 166512123 |
| Molecular Formula | C13H10F2N2OS2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nccs1)N1Cc2cc(F)c(F)cc2C1 |
| InChI | InChI=1S/C13H10F2N2OS2/c14-10-3-8-5-17(6-9(8)4-11(10)15)12(18)7-20-13-16-1-2-19-13/h1-4H,5-7H2 |
| InChIKey | PZLFCTMAJWUXBW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|