C24H16N4S2 — CID 166512382
5,10-bis(4-methylphenyl)-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazole (PubChem CID 166512382) has the molecular formula C24H16N4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 5,10-bis(4-methylphenyl)-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazole.
| Compound Name | 5,10-bis(4-methylphenyl)-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 166512382 |
| Molecular Formula | C24H16N4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 5,10-bis(4-methylphenyl)-[2,1,3]benzothiadiazolo[7,6-g][2,1,3]benzothiadiazole |
| SMILES | Cc1ccc(-c2cc3c(cc(-c4ccc(C)cc4)c4nsnc43)c3nsnc23)cc1 |
| InChI | InChI=1S/C24H16N4S2/c1-13-3-7-15(8-4-13)17-11-19-20(23-21(17)25-29-27-23)12-18(22-24(19)28-30-26-22)16-9-5-14(2)6-10-16/h3-12H,1-2H3 |
| InChIKey | COHNOTHHQWGZAW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |