C14H12N6S2 — CID 166512480
4-(5-amino-7-methyl-2,1,3-benzothiadiazol-4-yl)-7-methyl-2,1,3-benzothiadiazol-5-amine (PubChem CID 166512480) has the molecular formula C14H12N6S2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-(5-amino-7-methyl-2,1,3-benzothiadiazol-4-yl)-7-methyl-2,1,3-benzothiadiazol-5-amine.
| Compound Name | 4-(5-amino-7-methyl-2,1,3-benzothiadiazol-4-yl)-7-methyl-2,1,3-benzothiadiazol-5-amine |
|---|---|
| PubChem CID | 166512480 |
| Molecular Formula | C14H12N6S2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-(5-amino-7-methyl-2,1,3-benzothiadiazol-4-yl)-7-methyl-2,1,3-benzothiadiazol-5-amine |
| SMILES | Cc1cc(N)c(-c2c(N)cc(C)c3nsnc23)c2nsnc12 |
| InChI | InChI=1S/C14H12N6S2/c1-5-3-7(15)9(13-11(5)17-21-19-13)10-8(16)4-6(2)12-14(10)20-22-18-12/h3-4H,15-16H2,1-2H3 |
| InChIKey | HGAGJGCNWFTKEL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|