About 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole
6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole (PubChem CID 166512574) has the molecular formula C16H12STe
and a molecular weight of 363.94 g/mol. Its IUPAC name is 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole.
Molecular Properties
| Compound Name | 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole |
| PubChem CID | 166512574 |
| Molecular Formula | C16H12STe |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole |
| SMILES | Cc1cc2cc3cc(C4=CC=CC4)[te]c3cc2s1 |
| InChI | InChI=1S/C16H12STe/c1-10-6-12-7-13-8-15(11-4-2-3-5-11)18-16(13)9-14(12)17-10/h2-4,6-9H,5H2,1H3 |
| InChIKey | FNVDWTFYXSLHFW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole?
The IUPAC name of 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole (CID 166512574) is 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole.
What is the SMILES notation for 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole?
The canonical SMILES for 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole is Cc1cc2cc3cc(C4=CC=CC4)[te]c3cc2s1.
What is the InChIKey of 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole?
The InChIKey is FNVDWTFYXSLHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12STe/c1-10-6-12-7-13-8-15(11-4-2-3-5-11)18-16(13)9-14(12)17-10/h2-4,6-9H,5H2,1H3.
What are the key properties of 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole?
6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole has a molecular weight of 363.94 g/mol, XLogP of 4.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopenta-1,3-dien-1-yl-2-methyltelluropheno[3,2-f][1]benzothiole is sourced from PubChem (CID 166512574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).