About N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide
N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide (PubChem CID 166513179) has the molecular formula C9H13N3O3
and a molecular weight of 214.24 g/mol. Its IUPAC name is N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
| PubChem CID | 166513179 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
| SMILES | [2H]C([2H])([2H])n1cc(NC=O)c(O[C@@H]2CO[C@H]2C)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-6-8(4-14-6)15-9-7(10-5-13)3-12(2)11-9/h3,5-6,8H,4H2,1-2H3,(H,10,13)/t6-,8+/m0/s1/i2D3 |
| InChIKey | HNAIIXWTYNBHRS-CIAVROJHSA-N |
| XLogP | 0.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide?
The IUPAC name of N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide (CID 166513179) is N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide.
What is the SMILES notation for N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide?
The canonical SMILES for N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide is [2H]C([2H])([2H])n1cc(NC=O)c(O[C@@H]2CO[C@H]2C)n1.
What is the InChIKey of N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide?
The InChIKey is HNAIIXWTYNBHRS-CIAVROJHSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-6-8(4-14-6)15-9-7(10-5-13)3-12(2)11-9/h3,5-6,8H,4H2,1-2H3,(H,10,13)/t6-,8+/m0/s1/i2D3.
What are the key properties of N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide?
N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide has a molecular weight of 214.24 g/mol, XLogP of 0.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2S,3R)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide is sourced from PubChem (CID 166513179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).