About N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide
N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide (PubChem CID 166513206) has the molecular formula C10H15N3O4
and a molecular weight of 241.25 g/mol. Its IUPAC name is N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide |
| PubChem CID | 166513206 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide |
| SMILES | CO[C@@H]1COC[C@H]1Oc1nn(C)cc1NC=O |
| InChI | InChI=1S/C10H15N3O4/c1-13-3-7(11-6-14)10(12-13)17-9-5-16-4-8(9)15-2/h3,6,8-9H,4-5H2,1-2H3,(H,11,14)/t8-,9-/m1/s1 |
| InChIKey | WIQNUYFVWBDSOB-RKDXNWHRSA-N |
| XLogP | -0.22 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide?
The IUPAC name of N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide (CID 166513206) is N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide.
What is the SMILES notation for N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide?
The canonical SMILES for N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide is CO[C@@H]1COC[C@H]1Oc1nn(C)cc1NC=O.
What is the InChIKey of N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide?
The InChIKey is WIQNUYFVWBDSOB-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-13-3-7(11-6-14)10(12-13)17-9-5-16-4-8(9)15-2/h3,6,8-9H,4-5H2,1-2H3,(H,11,14)/t8-,9-/m1/s1.
What are the key properties of N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide?
N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide has a molecular weight of 241.25 g/mol, XLogP of -0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3R,4R)-4-methoxyoxolan-3-yl]oxy-1-methylpyrazol-4-yl]formamide is sourced from PubChem (CID 166513206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).