About 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine
3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine (PubChem CID 166513213) has the molecular formula C8H13N3O2
and a molecular weight of 186.23 g/mol. Its IUPAC name is 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine |
| PubChem CID | 166513213 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine |
| SMILES | [2H]C([2H])([2H])n1cc(N)c(O[C@H]2CO[C@@H]2C)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-5-7(4-12-5)13-8-6(9)3-11(2)10-8/h3,5,7H,4,9H2,1-2H3/t5-,7+/m1/s1/i2D3 |
| InChIKey | BCNCHGLJGJKOJI-LXDJNTKDSA-N |
| XLogP | 0.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine?
The IUPAC name of 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine (CID 166513213) is 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine.
What is the SMILES notation for 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine?
The canonical SMILES for 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine is [2H]C([2H])([2H])n1cc(N)c(O[C@H]2CO[C@@H]2C)n1.
What is the InChIKey of 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine?
The InChIKey is BCNCHGLJGJKOJI-LXDJNTKDSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5-7(4-12-5)13-8-6(9)3-11(2)10-8/h3,5,7H,4,9H2,1-2H3/t5-,7+/m1/s1/i2D3.
What are the key properties of 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine?
3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine has a molecular weight of 186.23 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-amine is sourced from PubChem (CID 166513213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).