C9H13N3O3 — CID 166513250
N-[3-[(2S,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide (PubChem CID 166513250) has the molecular formula C9H13N3O3 and a molecular weight of 214.24 g/mol. Its IUPAC name is N-[3-[(2S,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide.
| Compound Name | N-[3-[(2S,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 166513250 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[3-[(2S,3S)-2-methyloxetan-3-yl]oxy-1-(trideuteriomethyl)pyrazol-4-yl]formamide |
| SMILES | [2H]C([2H])([2H])n1cc(NC=O)c(O[C@H]2CO[C@H]2C)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-6-8(4-14-6)15-9-7(10-5-13)3-12(2)11-9/h3,5-6,8H,4H2,1-2H3,(H,10,13)/t6-,8-/m0/s1/i2D3 |
| InChIKey | HNAIIXWTYNBHRS-IWJBEIAYSA-N |
| XLogP | 0.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|