About 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole
1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole (PubChem CID 166513265) has the molecular formula C7H8F3N3O3
and a molecular weight of 239.15 g/mol. Its IUPAC name is 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole |
| PubChem CID | 166513265 |
| Molecular Formula | C7H8F3N3O3 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole |
| SMILES | CC(Oc1nn(C)cc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O3/c1-4(7(8,9)10)16-6-5(13(14)15)3-12(2)11-6/h3-4H,1-2H3 |
| InChIKey | BQCHZAKNSPJGBB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole?
The IUPAC name of 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole (CID 166513265) is 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole.
What is the SMILES notation for 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole?
The canonical SMILES for 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole is CC(Oc1nn(C)cc1[N+](=O)[O-])C(F)(F)F.
What is the InChIKey of 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole?
The InChIKey is BQCHZAKNSPJGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O3/c1-4(7(8,9)10)16-6-5(13(14)15)3-12(2)11-6/h3-4H,1-2H3.
What are the key properties of 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole?
1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole has a molecular weight of 239.15 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-3-(1,1,1-trifluoropropan-2-yloxy)pyrazole is sourced from PubChem (CID 166513265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).