About 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole
3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole (PubChem CID 166513288) has the molecular formula C9H11F2N3O3
and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole |
| PubChem CID | 166513288 |
| Molecular Formula | C9H11F2N3O3 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole |
| SMILES | CC(C(F)F)n1cc([N+](=O)[O-])c(OC2CC2)n1 |
| InChI | InChI=1S/C9H11F2N3O3/c1-5(8(10)11)13-4-7(14(15)16)9(12-13)17-6-2-3-6/h4-6,8H,2-3H2,1H3 |
| InChIKey | PGCJQOCRNXVNCF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole?
The IUPAC name of 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole (CID 166513288) is 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole.
What is the SMILES notation for 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole?
The canonical SMILES for 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole is CC(C(F)F)n1cc([N+](=O)[O-])c(OC2CC2)n1.
What is the InChIKey of 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole?
The InChIKey is PGCJQOCRNXVNCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O3/c1-5(8(10)11)13-4-7(14(15)16)9(12-13)17-6-2-3-6/h4-6,8H,2-3H2,1H3.
What are the key properties of 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole?
3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole has a molecular weight of 247.20 g/mol, XLogP of 2.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-1-(1,1-difluoropropan-2-yl)-4-nitropyrazole is sourced from PubChem (CID 166513288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).