About methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate
methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate (PubChem CID 166513333) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate |
| PubChem CID | 166513333 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate |
| SMILES | COC(=O)CN[C@H]1COC[C@@H]1OC |
| InChI | InChI=1S/C8H15NO4/c1-11-7-5-13-4-6(7)9-3-8(10)12-2/h6-7,9H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | HJDMROUIIZGJFT-BQBZGAKWSA-N |
| XLogP | -0.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate?
The IUPAC name of methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate (CID 166513333) is methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate.
What is the SMILES notation for methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate?
The canonical SMILES for methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate is COC(=O)CN[C@H]1COC[C@@H]1OC.
What is the InChIKey of methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate?
The InChIKey is HJDMROUIIZGJFT-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15NO4/c1-11-7-5-13-4-6(7)9-3-8(10)12-2/h6-7,9H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate?
methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate has a molecular weight of 189.21 g/mol, XLogP of -0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3S,4R)-4-methoxyoxolan-3-yl]amino]acetate is sourced from PubChem (CID 166513333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).