About N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide
N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide (PubChem CID 166513397) has the molecular formula C9H12F3N3O2
and a molecular weight of 251.21 g/mol. Its IUPAC name is N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide |
| PubChem CID | 166513397 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide |
| SMILES | CC(C)Oc1nn(CC(F)(F)F)cc1NC=O |
| InChI | InChI=1S/C9H12F3N3O2/c1-6(2)17-8-7(13-5-16)3-15(14-8)4-9(10,11)12/h3,5-6H,4H2,1-2H3,(H,13,16) |
| InChIKey | WZXDGLCAEQAWSW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide?
The IUPAC name of N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide (CID 166513397) is N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide.
What is the SMILES notation for N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide?
The canonical SMILES for N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide is CC(C)Oc1nn(CC(F)(F)F)cc1NC=O.
What is the InChIKey of N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide?
The InChIKey is WZXDGLCAEQAWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O2/c1-6(2)17-8-7(13-5-16)3-15(14-8)4-9(10,11)12/h3,5-6H,4H2,1-2H3,(H,13,16).
What are the key properties of N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide?
N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide has a molecular weight of 251.21 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-propan-2-yloxy-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]formamide is sourced from PubChem (CID 166513397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).