C10H16ClF3N2O — CID 166513714
(3-methylpiperazin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride (PubChem CID 166513714) has the molecular formula C10H16ClF3N2O and a molecular weight of 272.70 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride.
| Compound Name | (3-methylpiperazin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 166513714 |
| Molecular Formula | C10H16ClF3N2O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (3-methylpiperazin-1-yl)-[1-(trifluoromethyl)cyclopropyl]methanone;hydrochloride |
| SMILES | CC1CN(C(=O)C2(C(F)(F)F)CC2)CCN1.Cl |
| InChI | InChI=1S/C10H15F3N2O.ClH/c1-7-6-15(5-4-14-7)8(16)9(2-3-9)10(11,12)13;/h7,14H,2-6H2,1H3;1H |
| InChIKey | SZGOKYKITHEYDF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |