C12H11BrF3NO — CID 166513730
N-[(3-bromophenyl)methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 166513730) has the molecular formula C12H11BrF3NO and a molecular weight of 322.12 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166513730 |
| Molecular Formula | C12H11BrF3NO |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H11BrF3NO/c13-9-3-1-2-8(6-9)7-17-10(18)11(4-5-11)12(14,15)16/h1-3,6H,4-5,7H2,(H,17,18) |
| InChIKey | XPFICIAVUDGJHU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |