C24H19N7O — CID 166513924
4-[[8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-oxo-5,7-dihydropteridin-2-yl]amino]benzonitrile (PubChem CID 166513924) has the molecular formula C24H19N7O and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-[[8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-oxo-5,7-dihydropteridin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-oxo-5,7-dihydropteridin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 166513924 |
| Molecular Formula | C24H19N7O |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[[8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-oxo-5,7-dihydropteridin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1N1CC(=O)Nc2cnc(Nc3ccc(C#N)cc3)nc21 |
| InChI | InChI=1S/C24H19N7O/c1-15-10-18(4-3-9-25)11-16(2)22(15)31-14-21(32)29-20-13-27-24(30-23(20)31)28-19-7-5-17(12-26)6-8-19/h3-8,10-11,13H,14H2,1-2H3,(H,29,32)(H,27,28,30)/b4-3+ |
| InChIKey | QRFWWEONRMHITJ-ONEGZZNKSA-N |
| XLogP | 4.34 |
| TPSA | 117.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|