About 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane
8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane (PubChem CID 166513968) has the molecular formula C21H19Cl2N5O4
and a molecular weight of 476.32 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane.
Molecular Properties
| Compound Name | 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane |
| PubChem CID | 166513968 |
| Molecular Formula | C21H19Cl2N5O4 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane |
| SMILES | C1COCCO1.Cn1c(=O)[nH]c2nc(-c3ccccc3Cl)n(-c3ccc(Cl)nc3)c2c1=O |
| InChI | InChI=1S/C17H11Cl2N5O2.C4H8O2/c1-23-16(25)13-14(22-17(23)26)21-15(10-4-2-3-5-11(10)18)24(13)9-6-7-12(19)20-8-9;1-2-6-4-3-5-1/h2-8H,1H3,(H,22,26);1-4H2 |
| InChIKey | LWBUPZYCYWXFAK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane?
The IUPAC name of 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane (CID 166513968) is 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane.
What is the SMILES notation for 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane?
The canonical SMILES for 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane is C1COCCO1.Cn1c(=O)[nH]c2nc(-c3ccccc3Cl)n(-c3ccc(Cl)nc3)c2c1=O.
What is the InChIKey of 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane?
The InChIKey is LWBUPZYCYWXFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2N5O2.C4H8O2/c1-23-16(25)13-14(22-17(23)26)21-15(10-4-2-3-5-11(10)18)24(13)9-6-7-12(19)20-8-9;1-2-6-4-3-5-1/h2-8H,1H3,(H,22,26);1-4H2.
What are the key properties of 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane?
8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane has a molecular weight of 476.32 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-chlorophenyl)-7-(6-chloro-3-pyridinyl)-1-methyl-3H-purine-2,6-dione;1,4-dioxane is sourced from PubChem (CID 166513968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).