About 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol
5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol (PubChem CID 166514340) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol.
Molecular Properties
| Compound Name | 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol |
| PubChem CID | 166514340 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol |
| SMILES | COc1c(C)c(OC)c(O)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C15H17NO3/c1-9-14(18-2)12(16)11(13(17)15(9)19-3)10-7-5-4-6-8-10/h4-8,17H,16H2,1-3H3 |
| InChIKey | JJBYFEFZRWMQAO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol?
The IUPAC name of 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol (CID 166514340) is 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol.
What is the SMILES notation for 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol?
The canonical SMILES for 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol is COc1c(C)c(OC)c(O)c(-c2ccccc2)c1N.
What is the InChIKey of 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol?
The InChIKey is JJBYFEFZRWMQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-9-14(18-2)12(16)11(13(17)15(9)19-3)10-7-5-4-6-8-10/h4-8,17H,16H2,1-3H3.
What are the key properties of 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol?
5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol has a molecular weight of 259.31 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dimethoxy-3-methyl-6-phenylphenol is sourced from PubChem (CID 166514340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).