C24H17FN2O2 — CID 166514474
7-(4-fluorophenyl)-2-methoxy-3-(4-methylimidazol-1-yl)fluoren-9-one (PubChem CID 166514474) has the molecular formula C24H17FN2O2 and a molecular weight of 384.41 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-2-methoxy-3-(4-methylimidazol-1-yl)fluoren-9-one.
| Compound Name | 7-(4-fluorophenyl)-2-methoxy-3-(4-methylimidazol-1-yl)fluoren-9-one |
|---|---|
| PubChem CID | 166514474 |
| Molecular Formula | C24H17FN2O2 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 7-(4-fluorophenyl)-2-methoxy-3-(4-methylimidazol-1-yl)fluoren-9-one |
| SMILES | COc1cc2c(cc1-n1cnc(C)c1)-c1ccc(-c3ccc(F)cc3)cc1C2=O |
| InChI | InChI=1S/C24H17FN2O2/c1-14-12-27(13-26-14)22-10-19-18-8-5-16(15-3-6-17(25)7-4-15)9-20(18)24(28)21(19)11-23(22)29-2/h3-13H,1-2H3 |
| InChIKey | MZNTWFGFIZEZCG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |