About 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol
3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol (PubChem CID 166514996) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol |
| PubChem CID | 166514996 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol |
| SMILES | C=CCOCCC(C)C(O)C(C)CCOCC=C |
| InChI | InChI=1S/C15H28O3/c1-5-9-17-11-7-13(3)15(16)14(4)8-12-18-10-6-2/h5-6,13-16H,1-2,7-12H2,3-4H3 |
| InChIKey | AUPFKBFKMFKKAV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol?
The IUPAC name of 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol (CID 166514996) is 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol.
What is the SMILES notation for 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol?
The canonical SMILES for 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol is C=CCOCCC(C)C(O)C(C)CCOCC=C.
What is the InChIKey of 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol?
The InChIKey is AUPFKBFKMFKKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-5-9-17-11-7-13(3)15(16)14(4)8-12-18-10-6-2/h5-6,13-16H,1-2,7-12H2,3-4H3.
What are the key properties of 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol?
3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol has a molecular weight of 256.39 g/mol, XLogP of 2.80, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,7-bis(prop-2-enoxy)heptan-4-ol is sourced from PubChem (CID 166514996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).