C22H26O2 — CID 166515280
1,4-bis(4-propan-2-ylphenyl)butane-1,4-dione (PubChem CID 166515280) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1,4-bis(4-propan-2-ylphenyl)butane-1,4-dione.
| Compound Name | 1,4-bis(4-propan-2-ylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 166515280 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1,4-bis(4-propan-2-ylphenyl)butane-1,4-dione |
| SMILES | CC(C)c1ccc(C(=O)CCC(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26O2/c1-15(2)17-5-9-19(10-6-17)21(23)13-14-22(24)20-11-7-18(8-12-20)16(3)4/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | LSBFXVPWEBLADJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |