About 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine
2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine (PubChem CID 166515523) has the molecular formula C17H13BrFNO2
and a molecular weight of 362.20 g/mol. Its IUPAC name is 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine |
| PubChem CID | 166515523 |
| Molecular Formula | C17H13BrFNO2 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine |
| SMILES | Cc1c(Br)cccc1/C=C(\F)c1ccc(C2OC=CO2)cn1 |
| InChI | InChI=1S/C17H13BrFNO2/c1-11-12(3-2-4-14(11)18)9-15(19)16-6-5-13(10-20-16)17-21-7-8-22-17/h2-10,17H,1H3/b15-9- |
| InChIKey | XBZDQNIGFIXOEI-DHDCSXOGSA-N |
| XLogP | 5.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine?
The IUPAC name of 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine (CID 166515523) is 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine.
What is the SMILES notation for 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine?
The canonical SMILES for 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine is Cc1c(Br)cccc1/C=C(\F)c1ccc(C2OC=CO2)cn1.
What is the InChIKey of 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine?
The InChIKey is XBZDQNIGFIXOEI-DHDCSXOGSA-N. The full InChI is InChI=1S/C17H13BrFNO2/c1-11-12(3-2-4-14(11)18)9-15(19)16-6-5-13(10-20-16)17-21-7-8-22-17/h2-10,17H,1H3/b15-9-.
What are the key properties of 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine?
2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine has a molecular weight of 362.20 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-5-(1,3-dioxol-2-yl)pyridine is sourced from PubChem (CID 166515523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).