C24H20N2O2S — CID 16651563
N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-4-phenoxybenzamide (PubChem CID 16651563) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 16651563 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-4-phenoxybenzamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)c3ccc(Oc4ccccc4)cc3)s2)c1 |
| InChI | InChI=1S/C24H20N2O2S/c1-17-6-5-7-18(14-17)15-22-16-25-24(29-22)26-23(27)19-10-12-21(13-11-19)28-20-8-3-2-4-9-20/h2-14,16H,15H2,1H3,(H,25,26,27) |
| InChIKey | RDGNWEOOFZKCOV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |