C22H23BN2O4 — CID 166516845
8-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 166516845) has the molecular formula C22H23BN2O4 and a molecular weight of 390.25 g/mol. Its IUPAC name is 8-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | 8-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 166516845 |
| Molecular Formula | C22H23BN2O4 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 8-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1-c1ccn2c(=O)c(C=O)cnc2c1 |
| InChI | InChI=1S/C22H23BN2O4/c1-14-17(7-6-8-18(14)23-28-21(2,3)22(4,5)29-23)15-9-10-25-19(11-15)24-12-16(13-26)20(25)27/h6-13H,1-5H3 |
| InChIKey | ONPSJUNNAJSGCC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|