C17H29F3N2O3Si — CID 166516955
ethyl 3-[[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166516955) has the molecular formula C17H29F3N2O3Si and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 3-[[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166516955 |
| Molecular Formula | C17H29F3N2O3Si |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethyl 3-[[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C17H29F3N2O3Si/c1-7-24-15(23)14-12(8-10-22-14)21-11-9-13(17(18,19)20)25-26(5,6)16(2,3)4/h8,10,13,21-22H,7,9,11H2,1-6H3 |
| InChIKey | VMHVHIGOCZSENY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|