C14H21F3N2O3 — CID 166516962
ethyl 4,5-dimethyl-3-[2-(1,1,1-trifluoropropan-2-yloxy)ethylamino]-1H-pyrrole-2-carboxylate (PubChem CID 166516962) has the molecular formula C14H21F3N2O3 and a molecular weight of 322.33 g/mol. Its IUPAC name is ethyl 4,5-dimethyl-3-[2-(1,1,1-trifluoropropan-2-yloxy)ethylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4,5-dimethyl-3-[2-(1,1,1-trifluoropropan-2-yloxy)ethylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166516962 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | ethyl 4,5-dimethyl-3-[2-(1,1,1-trifluoropropan-2-yloxy)ethylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C)c1NCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O3/c1-5-21-13(20)12-11(8(2)9(3)19-12)18-6-7-22-10(4)14(15,16)17/h10,18-19H,5-7H2,1-4H3 |
| InChIKey | OPXAKLFVCWOCPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|