C16H22F3N3O5S — CID 166516977
ethyl 3-[ethoxycarbonylcarbamothioyl-[4,4,4-trifluoro-3-(hydroxymethyl)butyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166516977) has the molecular formula C16H22F3N3O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is ethyl 3-[ethoxycarbonylcarbamothioyl-[4,4,4-trifluoro-3-(hydroxymethyl)butyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[4,4,4-trifluoro-3-(hydroxymethyl)butyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166516977 |
| Molecular Formula | C16H22F3N3O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[4,4,4-trifluoro-3-(hydroxymethyl)butyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NC(=S)N(CCC(CO)C(F)(F)F)c1cc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C16H22F3N3O5S/c1-3-26-13(24)12-11(5-7-20-12)22(14(28)21-15(25)27-4-2)8-6-10(9-23)16(17,18)19/h5,7,10,20,23H,3-4,6,8-9H2,1-2H3,(H,21,25,28) |
| InChIKey | OIOJVRGZOLBWAZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|