C13H20N2O5 — CID 166516983
ethyl 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate (PubChem CID 166516983) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166516983 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(OC)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N2O5/c1-6-19-11(16)10-9(8(18-5)7-14-10)15-12(17)20-13(2,3)4/h7,14H,6H2,1-5H3,(H,15,17) |
| InChIKey | AYZZLOXVFNJDJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |