About ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate
ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate (PubChem CID 166516990) has the molecular formula C13H20F3N3O3
and a molecular weight of 323.32 g/mol. Its IUPAC name is ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate |
| PubChem CID | 166516990 |
| Molecular Formula | C13H20F3N3O3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]ccc1NCCOC(CNC)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O3/c1-3-21-12(20)11-9(4-5-19-11)18-6-7-22-10(8-17-2)13(14,15)16/h4-5,10,17-19H,3,6-8H2,1-2H3 |
| InChIKey | UKAMABYKRHCAKD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate (CID 166516990) is ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]ccc1NCCOC(CNC)C(F)(F)F.
What is the InChIKey of ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate?
The InChIKey is UKAMABYKRHCAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N3O3/c1-3-21-12(20)11-9(4-5-19-11)18-6-7-22-10(8-17-2)13(14,15)16/h4-5,10,17-19H,3,6-8H2,1-2H3.
What are the key properties of ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate?
ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate has a molecular weight of 323.32 g/mol, XLogP of 1.77, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-[1,1,1-trifluoro-3-(methylamino)propan-2-yl]oxyethylamino]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 166516990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).