C11H13F3N4O2S — CID 166517092
1-[2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyethyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 166517092) has the molecular formula C11H13F3N4O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-[2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyethyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 1-[2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyethyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166517092 |
| Molecular Formula | C11H13F3N4O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-[2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyethyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | NCC(OCCn1c(=S)[nH]c(=O)c2[nH]ccc21)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O2S/c12-11(13,14)7(5-15)20-4-3-18-6-1-2-16-8(6)9(19)17-10(18)21/h1-2,7,16H,3-5,15H2,(H,17,19,21) |
| InChIKey | AIMJRYJTBDDKBQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|