C17H24F3N3O5S — CID 166517106
ethyl 3-[ethoxycarbonylcarbamothioyl-(3,3,3-trifluoro-2-propoxypropyl)amino]-1H-pyrrole-2-carboxylate (PubChem CID 166517106) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is ethyl 3-[ethoxycarbonylcarbamothioyl-(3,3,3-trifluoro-2-propoxypropyl)amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[ethoxycarbonylcarbamothioyl-(3,3,3-trifluoro-2-propoxypropyl)amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517106 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl 3-[ethoxycarbonylcarbamothioyl-(3,3,3-trifluoro-2-propoxypropyl)amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCCOC(CN(C(=S)NC(=O)OCC)c1cc[nH]c1C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O5S/c1-4-9-28-12(17(18,19)20)10-23(15(29)22-16(25)27-6-3)11-7-8-21-13(11)14(24)26-5-2/h7-8,12,21H,4-6,9-10H2,1-3H3,(H,22,25,29) |
| InChIKey | NBVGADLKYCMRGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|