C15H20F3N3O5S — CID 166517125
ethyl 3-[ethoxycarbonylcarbamothioyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166517125) has the molecular formula C15H20F3N3O5S and a molecular weight of 411.40 g/mol. Its IUPAC name is ethyl 3-[ethoxycarbonylcarbamothioyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166517125 |
| Molecular Formula | C15H20F3N3O5S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | ethyl 3-[ethoxycarbonylcarbamothioyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)NC(=S)N(CCOCC(F)(F)F)c1cc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C15H20F3N3O5S/c1-3-25-12(22)11-10(5-6-19-11)21(7-8-24-9-15(16,17)18)13(27)20-14(23)26-4-2/h5-6,19H,3-4,7-9H2,1-2H3,(H,20,23,27) |
| InChIKey | RGNYAOPQHWLMDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|