About 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one
7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one (PubChem CID 166517293) has the molecular formula C16H14F3N3O2S
and a molecular weight of 369.37 g/mol. Its IUPAC name is 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one.
Molecular Properties
| Compound Name | 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one |
| PubChem CID | 166517293 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one |
| SMILES | CC(O)c1cnc(Nc2ccc3c(=O)cc(C(F)(F)F)n(C)c3c2)s1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-8(23)13-7-20-15(25-13)21-9-3-4-10-11(5-9)22(2)14(6-12(10)24)16(17,18)19/h3-8,23H,1-2H3,(H,20,21) |
| InChIKey | OQWJSFMFTOTURD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one?
The IUPAC name of 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one (CID 166517293) is 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one.
What is the SMILES notation for 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one?
The canonical SMILES for 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one is CC(O)c1cnc(Nc2ccc3c(=O)cc(C(F)(F)F)n(C)c3c2)s1.
What is the InChIKey of 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one?
The InChIKey is OQWJSFMFTOTURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3O2S/c1-8(23)13-7-20-15(25-13)21-9-3-4-10-11(5-9)22(2)14(6-12(10)24)16(17,18)19/h3-8,23H,1-2H3,(H,20,21).
What are the key properties of 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one?
7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one has a molecular weight of 369.37 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[5-(1-hydroxyethyl)-1,3-thiazol-2-yl]amino]-1-methyl-2-(trifluoromethyl)quinolin-4-one is sourced from PubChem (CID 166517293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).