C22H20F4N6O4 — CID 166517693
4-ethyl-2-[8-fluoro-4-(2-methylphenoxy)-5-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrido[3,4-d]pyridazin-7-yl]-5-(hydroxymethyl)-1,2,4-triazol-3-one (PubChem CID 166517693) has the molecular formula C22H20F4N6O4 and a molecular weight of 508.43 g/mol. Its IUPAC name is 4-ethyl-2-[8-fluoro-4-(2-methylphenoxy)-5-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrido[3,4-d]pyridazin-7-yl]-5-(hydroxymethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-ethyl-2-[8-fluoro-4-(2-methylphenoxy)-5-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrido[3,4-d]pyridazin-7-yl]-5-(hydroxymethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 166517693 |
| Molecular Formula | C22H20F4N6O4 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 4-ethyl-2-[8-fluoro-4-(2-methylphenoxy)-5-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrido[3,4-d]pyridazin-7-yl]-5-(hydroxymethyl)-1,2,4-triazol-3-one |
| SMILES | CCn1c(CO)nn(-c2nc(O[C@@H](C)C(F)(F)F)c3c(Oc4ccccc4C)nncc3c2F)c1=O |
| InChI | InChI=1S/C22H20F4N6O4/c1-4-31-15(10-33)30-32(21(31)34)18-17(23)13-9-27-29-20(36-14-8-6-5-7-11(14)2)16(13)19(28-18)35-12(3)22(24,25)26/h5-9,12,33H,4,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | XWZKGLGDJXCXRU-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |