C22H19BrN8O2 — CID 166517753
(1R,3S,5R)-2-[2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetyl]-N-(6-bromo-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 166517753) has the molecular formula C22H19BrN8O2 and a molecular weight of 507.35 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetyl]-N-(6-bromo-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-2-[2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetyl]-N-(6-bromo-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 166517753 |
| Molecular Formula | C22H19BrN8O2 |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (1R,3S,5R)-2-[2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetyl]-N-(6-bromo-2-pyridinyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Nc1ncnc2c1c1ccncc1n2CC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C22H19BrN8O2/c23-16-2-1-3-17(28-16)29-22(33)14-7-11-6-13(11)31(14)18(32)9-30-15-8-25-5-4-12(15)19-20(24)26-10-27-21(19)30/h1-5,8,10-11,13-14H,6-7,9H2,(H2,24,26,27)(H,28,29,33)/t11-,13-,14+/m1/s1 |
| InChIKey | MPPSMBGWRFVJMD-BNOWGMLFSA-N |
| XLogP | 2.35 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|