C15H17N5O2 — CID 166517846
tert-butyl 2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetate (PubChem CID 166517846) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is tert-butyl 2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetate.
| Compound Name | tert-butyl 2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetate |
|---|---|
| PubChem CID | 166517846 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl 2-(3-amino-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c2cnccc2c2c(N)ncnc21 |
| InChI | InChI=1S/C15H17N5O2/c1-15(2,3)22-11(21)7-20-10-6-17-5-4-9(10)12-13(16)18-8-19-14(12)20/h4-6,8H,7H2,1-3H3,(H2,16,18,19) |
| InChIKey | VKGLHTLBVIVJTR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |