C31H37F2N3OSi — CID 166518862
2-[[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-6-fluoro-5-(2-fluoro-6-methylphenyl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 166518862) has the molecular formula C31H37F2N3OSi and a molecular weight of 533.74 g/mol. Its IUPAC name is 2-[[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-6-fluoro-5-(2-fluoro-6-methylphenyl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-6-fluoro-5-(2-fluoro-6-methylphenyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 166518862 |
| Molecular Formula | C31H37F2N3OSi |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 2-[[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-6-fluoro-5-(2-fluoro-6-methylphenyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(-c2nn(COCC[Si](C)(C)C)c3cc(F)c(-c4c(C)cccc4F)cc23)cc2c1CCN(C)C2 |
| InChI | InChI=1S/C31H37F2N3OSi/c1-20-8-7-9-27(32)30(20)25-16-26-29(17-28(25)33)36(19-37-12-13-38(4,5)6)34-31(26)22-14-21(2)24-10-11-35(3)18-23(24)15-22/h7-9,14-17H,10-13,18-19H2,1-6H3 |
| InChIKey | SGOWEBCWKDEFCC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|