C28H33FN4O3 — CID 166519351
4-(2-ethylbutyl)-N-[3-(4-fluorophenoxy)-5-pyridin-4-yloxyphenyl]piperazine-1-carboxamide (PubChem CID 166519351) has the molecular formula C28H33FN4O3 and a molecular weight of 492.60 g/mol. Its IUPAC name is 4-(2-ethylbutyl)-N-[3-(4-fluorophenoxy)-5-pyridin-4-yloxyphenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-ethylbutyl)-N-[3-(4-fluorophenoxy)-5-pyridin-4-yloxyphenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 166519351 |
| Molecular Formula | C28H33FN4O3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 4-(2-ethylbutyl)-N-[3-(4-fluorophenoxy)-5-pyridin-4-yloxyphenyl]piperazine-1-carboxamide |
| SMILES | CCC(CC)CN1CCN(C(=O)Nc2cc(Oc3ccncc3)cc(Oc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C28H33FN4O3/c1-3-21(4-2)20-32-13-15-33(16-14-32)28(34)31-23-17-26(35-24-7-5-22(29)6-8-24)19-27(18-23)36-25-9-11-30-12-10-25/h5-12,17-19,21H,3-4,13-16,20H2,1-2H3,(H,31,34) |
| InChIKey | IMOBCXVGUHFSAP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |