C9H7Cl2F12O4P — CID 166519564
2-[2-dichlorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane (PubChem CID 166519564) has the molecular formula C9H7Cl2F12O4P and a molecular weight of 509.01 g/mol. Its IUPAC name is 2-[2-dichlorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 2-[2-dichlorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 166519564 |
| Molecular Formula | C9H7Cl2F12O4P |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 507.93 |
| IUPAC Name | 2-[2-dichlorophosphoryloxy-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-1,1,1,3,3,3-hexafluoropropane |
| SMILES | O=P(Cl)(Cl)OC(COC(C(F)(F)F)C(F)(F)F)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F12O4P/c10-28(11,24)27-3(1-25-4(6(12,13)14)7(15,16)17)2-26-5(8(18,19)20)9(21,22)23/h3-5H,1-2H2 |
| InChIKey | QBOGPJZKICBXHM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|